C28H31N3O2S — CID 4609928
N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-butylthiophene-2-carboxamide (PubChem CID 4609928) has the molecular formula C28H31N3O2S and a molecular weight of 473.64 g/mol. Its IUPAC name is N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-butylthiophene-2-carboxamide.
| Compound Name | N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-butylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 4609928 |
| Molecular Formula | C28H31N3O2S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-butylthiophene-2-carboxamide |
| SMILES | CCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccccc1)C(=O)c1cccs1 |
| InChI | InChI=1S/C28H31N3O2S/c1-2-3-16-31(28(33)26-14-9-18-34-26)21-27(32)30(20-22-10-5-4-6-11-22)17-15-23-19-29-25-13-8-7-12-24(23)25/h4-14,18-19,29H,2-3,15-17,20-21H2,1H3 |
| InChIKey | FIJMNDLMITZLFG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |