C35H42FN3O3 — CID 3396512
N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-hexyl-N-(2-methoxyethyl)benzamide (PubChem CID 3396512) has the molecular formula C35H42FN3O3 and a molecular weight of 571.74 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-hexyl-N-(2-methoxyethyl)benzamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-hexyl-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 3396512 |
| Molecular Formula | C35H42FN3O3 |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-hexyl-N-(2-methoxyethyl)benzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CCOC)CC(=O)N(CCc2c[nH]c3ccccc23)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C35H42FN3O3/c1-3-4-5-6-9-27-12-16-29(17-13-27)35(41)39(22-23-42-2)26-34(40)38(25-28-14-18-31(36)19-15-28)21-20-30-24-37-33-11-8-7-10-32(30)33/h7-8,10-19,24,37H,3-6,9,20-23,25-26H2,1-2H3 |
| InChIKey | YZFSGCNPFHOXAN-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|