C35H40FN3O2 — CID 42770597
N-cyclopropyl-N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-hexylbenzamide (PubChem CID 42770597) has the molecular formula C35H40FN3O2 and a molecular weight of 553.72 g/mol. Its IUPAC name is N-cyclopropyl-N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-hexylbenzamide.
| Compound Name | N-cyclopropyl-N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-hexylbenzamide |
|---|---|
| PubChem CID | 42770597 |
| Molecular Formula | C35H40FN3O2 |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | N-cyclopropyl-N-[2-[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-4-hexylbenzamide |
| SMILES | CCCCCCc1ccc(C(=O)N(CC(=O)N(CCc2c[nH]c3ccccc23)Cc2ccc(F)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C35H40FN3O2/c1-2-3-4-5-8-26-11-15-28(16-12-26)35(41)39(31-19-20-31)25-34(40)38(24-27-13-17-30(36)18-14-27)22-21-29-23-37-33-10-7-6-9-32(29)33/h6-7,9-18,23,31,37H,2-5,8,19-22,24-25H2,1H3 |
| InChIKey | NSSNEDJSMXRZCX-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|