C30H39N3O3 — CID 5237679
N-cyclopropyl-N-[2-[(4-ethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]hexanamide (PubChem CID 5237679) has the molecular formula C30H39N3O3 and a molecular weight of 489.66 g/mol. Its IUPAC name is N-cyclopropyl-N-[2-[(4-ethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]hexanamide.
| Compound Name | N-cyclopropyl-N-[2-[(4-ethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 5237679 |
| Molecular Formula | C30H39N3O3 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | N-cyclopropyl-N-[2-[(4-ethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]hexanamide |
| SMILES | CCCCCC(=O)N(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(OCC)cc1)C1CC1 |
| InChI | InChI=1S/C30H39N3O3/c1-3-5-6-11-29(34)33(25-14-15-25)22-30(35)32(21-23-12-16-26(17-13-23)36-4-2)19-18-24-20-31-28-10-8-7-9-27(24)28/h7-10,12-13,16-17,20,25,31H,3-6,11,14-15,18-19,21-22H2,1-2H3 |
| InChIKey | FZAGFCNXMROWOM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|