C29H37N3O2 — CID 3434547
N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-cyclopropylheptanamide (PubChem CID 3434547) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-cyclopropylheptanamide.
| Compound Name | N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-cyclopropylheptanamide |
|---|---|
| PubChem CID | 3434547 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | N-[2-[benzyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-cyclopropylheptanamide |
| SMILES | CCCCCCC(=O)N(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccccc1)C1CC1 |
| InChI | InChI=1S/C29H37N3O2/c1-2-3-4-8-15-28(33)32(25-16-17-25)22-29(34)31(21-23-11-6-5-7-12-23)19-18-24-20-30-27-14-10-9-13-26(24)27/h5-7,9-14,20,25,30H,2-4,8,15-19,21-22H2,1H3 |
| InChIKey | XQPGQFNNKSYJOX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|