C31H33N3O3 — CID 42772104
N-benzyl-2-[cyclopropyl-(2-phenylmethoxyacetyl)amino]-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 42772104) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is N-benzyl-2-[cyclopropyl-(2-phenylmethoxyacetyl)amino]-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | N-benzyl-2-[cyclopropyl-(2-phenylmethoxyacetyl)amino]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 42772104 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | N-benzyl-2-[cyclopropyl-(2-phenylmethoxyacetyl)amino]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | O=C(CN(C(=O)COCc1ccccc1)C1CC1)N(CCc1c[nH]c2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C31H33N3O3/c35-30(21-34(27-15-16-27)31(36)23-37-22-25-11-5-2-6-12-25)33(20-24-9-3-1-4-10-24)18-17-26-19-32-29-14-8-7-13-28(26)29/h1-14,19,27,32H,15-18,20-23H2 |
| InChIKey | FLMZAJAXQWQXRO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |