C32H37N5O5 — CID 46122444
N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-4-methyl-3-nitrobenzamide (PubChem CID 46122444) has the molecular formula C32H37N5O5 and a molecular weight of 571.68 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-4-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 46122444 |
| Molecular Formula | C32H37N5O5 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | N-[2-[[4-(dimethylamino)phenyl]methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-4-methyl-3-nitrobenzamide |
| SMILES | COCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(N(C)C)cc1)C(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H37N5O5/c1-23-9-12-25(19-30(23)37(40)41)32(39)36(17-18-42-4)22-31(38)35(21-24-10-13-27(14-11-24)34(2)3)16-15-26-20-33-29-8-6-5-7-28(26)29/h5-14,19-20,33H,15-18,21-22H2,1-4H3 |
| InChIKey | RWOUWAPSZYKDBW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|