C32H36N4O6 — CID 3362523
N-[2-[(4-ethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-4-methyl-3-nitrobenzamide (PubChem CID 3362523) has the molecular formula C32H36N4O6 and a molecular weight of 572.66 g/mol. Its IUPAC name is N-[2-[(4-ethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-4-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[(4-ethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 3362523 |
| Molecular Formula | C32H36N4O6 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | N-[2-[(4-ethoxyphenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]-2-oxoethyl]-N-(2-methoxyethyl)-4-methyl-3-nitrobenzamide |
| SMILES | CCOc1ccc(CN(CCc2c[nH]c3ccccc23)C(=O)CN(CCOC)C(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C32H36N4O6/c1-4-42-27-13-10-24(11-14-27)21-34(16-15-26-20-33-29-8-6-5-7-28(26)29)31(37)22-35(17-18-41-3)32(38)25-12-9-23(2)30(19-25)36(39)40/h5-14,19-20,33H,4,15-18,21-22H2,1-3H3 |
| InChIKey | DDUIUSGQKUYYSD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|