C36H38N2O3 — CID 42701759
4-butyl-N-[2-(1H-indol-3-yl)ethyl]-N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]benzamide (PubChem CID 42701759) has the molecular formula C36H38N2O3 and a molecular weight of 546.71 g/mol. Its IUPAC name is 4-butyl-N-[2-(1H-indol-3-yl)ethyl]-N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]benzamide.
| Compound Name | 4-butyl-N-[2-(1H-indol-3-yl)ethyl]-N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42701759 |
| Molecular Formula | C36H38N2O3 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 4-butyl-N-[2-(1H-indol-3-yl)ethyl]-N-[(4-methoxy-3-phenylmethoxyphenyl)methyl]benzamide |
| SMILES | CCCCc1ccc(C(=O)N(CCc2c[nH]c3ccccc23)Cc2ccc(OC)c(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C36H38N2O3/c1-3-4-10-27-15-18-30(19-16-27)36(39)38(22-21-31-24-37-33-14-9-8-13-32(31)33)25-29-17-20-34(40-2)35(23-29)41-26-28-11-6-5-7-12-28/h5-9,11-20,23-24,37H,3-4,10,21-22,25-26H2,1-2H3 |
| InChIKey | PQMYMTWUOCLKIX-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |