C31H27FN2O2 — CID 42698598
4-fluoro-N-[2-(1H-indol-3-yl)ethyl]-N-[(4-phenylmethoxyphenyl)methyl]benzamide (PubChem CID 42698598) has the molecular formula C31H27FN2O2 and a molecular weight of 478.57 g/mol. Its IUPAC name is 4-fluoro-N-[2-(1H-indol-3-yl)ethyl]-N-[(4-phenylmethoxyphenyl)methyl]benzamide.
| Compound Name | 4-fluoro-N-[2-(1H-indol-3-yl)ethyl]-N-[(4-phenylmethoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42698598 |
| Molecular Formula | C31H27FN2O2 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 4-fluoro-N-[2-(1H-indol-3-yl)ethyl]-N-[(4-phenylmethoxyphenyl)methyl]benzamide |
| SMILES | O=C(c1ccc(F)cc1)N(CCc1c[nH]c2ccccc12)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H27FN2O2/c32-27-14-12-25(13-15-27)31(35)34(19-18-26-20-33-30-9-5-4-8-29(26)30)21-23-10-16-28(17-11-23)36-22-24-6-2-1-3-7-24/h1-17,20,33H,18-19,21-22H2 |
| InChIKey | ADRHZYJLKDOMFX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |