C32H37N3O3 — CID 42657203
3-cyclohexyl-1-[2-(1H-indol-3-yl)ethyl]-1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]urea (PubChem CID 42657203) has the molecular formula C32H37N3O3 and a molecular weight of 511.67 g/mol. Its IUPAC name is 3-cyclohexyl-1-[2-(1H-indol-3-yl)ethyl]-1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]urea.
| Compound Name | 3-cyclohexyl-1-[2-(1H-indol-3-yl)ethyl]-1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42657203 |
| Molecular Formula | C32H37N3O3 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | 3-cyclohexyl-1-[2-(1H-indol-3-yl)ethyl]-1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CN(CCc2c[nH]c3ccccc23)C(=O)NC2CCCCC2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C32H37N3O3/c1-37-30-17-16-25(20-31(30)38-23-24-10-4-2-5-11-24)22-35(32(36)34-27-12-6-3-7-13-27)19-18-26-21-33-29-15-9-8-14-28(26)29/h2,4-5,8-11,14-17,20-21,27,33H,3,6-7,12-13,18-19,22-23H2,1H3,(H,34,36) |
| InChIKey | IIKUCKFMHGQFCZ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |