C37H40N4O3 — CID 42777852
N-[[4-(dimethylamino)phenyl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[(2-phenoxyacetyl)-(2-phenylethyl)amino]acetamide (PubChem CID 42777852) has the molecular formula C37H40N4O3 and a molecular weight of 588.75 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[(2-phenoxyacetyl)-(2-phenylethyl)amino]acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[(2-phenoxyacetyl)-(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 42777852 |
| Molecular Formula | C37H40N4O3 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[(2-phenoxyacetyl)-(2-phenylethyl)amino]acetamide |
| SMILES | CN(C)c1ccc(CN(CCc2c[nH]c3ccccc23)C(=O)CN(CCc2ccccc2)C(=O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C37H40N4O3/c1-39(2)32-19-17-30(18-20-32)26-40(24-22-31-25-38-35-16-10-9-15-34(31)35)36(42)27-41(23-21-29-11-5-3-6-12-29)37(43)28-44-33-13-7-4-8-14-33/h3-20,25,38H,21-24,26-28H2,1-2H3 |
| InChIKey | QSUBGAMBGBELJB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|