C24H27FN4OS — CID 24732177
3-(3-fluorophenyl)-1-(pyridin-3-ylmethyl)-1-[1-(2-thiophen-2-ylethyl)piperidin-4-yl]urea (PubChem CID 24732177) has the molecular formula C24H27FN4OS and a molecular weight of 438.57 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-(pyridin-3-ylmethyl)-1-[1-(2-thiophen-2-ylethyl)piperidin-4-yl]urea.
| Compound Name | 3-(3-fluorophenyl)-1-(pyridin-3-ylmethyl)-1-[1-(2-thiophen-2-ylethyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 24732177 |
| Molecular Formula | C24H27FN4OS |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 3-(3-fluorophenyl)-1-(pyridin-3-ylmethyl)-1-[1-(2-thiophen-2-ylethyl)piperidin-4-yl]urea |
| SMILES | O=C(Nc1cccc(F)c1)N(Cc1cccnc1)C1CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C24H27FN4OS/c25-20-5-1-6-21(16-20)27-24(30)29(18-19-4-2-11-26-17-19)22-8-12-28(13-9-22)14-10-23-7-3-15-31-23/h1-7,11,15-17,22H,8-10,12-14,18H2,(H,27,30) |
| InChIKey | CQIXLZBMXQZWNB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |