C32H32FN3O2 — CID 42703390
1-(1-benzylpiperidin-4-yl)-3-(3-fluorophenyl)-1-[(3-phenoxyphenyl)methyl]urea (PubChem CID 42703390) has the molecular formula C32H32FN3O2 and a molecular weight of 509.63 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-(3-fluorophenyl)-1-[(3-phenoxyphenyl)methyl]urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-(3-fluorophenyl)-1-[(3-phenoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42703390 |
| Molecular Formula | C32H32FN3O2 |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(3-fluorophenyl)-1-[(3-phenoxyphenyl)methyl]urea |
| SMILES | O=C(Nc1cccc(F)c1)N(Cc1cccc(Oc2ccccc2)c1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C32H32FN3O2/c33-27-12-8-13-28(22-27)34-32(37)36(29-17-19-35(20-18-29)23-25-9-3-1-4-10-25)24-26-11-7-16-31(21-26)38-30-14-5-2-6-15-30/h1-16,21-22,29H,17-20,23-24H2,(H,34,37) |
| InChIKey | ZZWKTAVQYLORMO-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |