C26H27F2N3O — CID 141100659
1-(1-benzylpiperidin-4-yl)-3-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]urea (PubChem CID 141100659) has the molecular formula C26H27F2N3O and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 141100659 |
| Molecular Formula | C26H27F2N3O |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(4-fluorophenyl)-1-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C(Nc1ccc(F)cc1)N(Cc1ccc(F)cc1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H27F2N3O/c27-22-8-6-21(7-9-22)19-31(26(32)29-24-12-10-23(28)11-13-24)25-14-16-30(17-15-25)18-20-4-2-1-3-5-20/h1-13,25H,14-19H2,(H,29,32) |
| InChIKey | BWCCGOLHMABNSQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |