C28H32ClN3O — CID 42702435
1-(1-benzylpiperidin-4-yl)-1-[(2-chlorophenyl)methyl]-3-(4-ethylphenyl)urea (PubChem CID 42702435) has the molecular formula C28H32ClN3O and a molecular weight of 462.04 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-1-[(2-chlorophenyl)methyl]-3-(4-ethylphenyl)urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-1-[(2-chlorophenyl)methyl]-3-(4-ethylphenyl)urea |
|---|---|
| PubChem CID | 42702435 |
| Molecular Formula | C28H32ClN3O |
| Molecular Weight | 462.04 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-1-[(2-chlorophenyl)methyl]-3-(4-ethylphenyl)urea |
| SMILES | CCc1ccc(NC(=O)N(Cc2ccccc2Cl)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H32ClN3O/c1-2-22-12-14-25(15-13-22)30-28(33)32(21-24-10-6-7-11-27(24)29)26-16-18-31(19-17-26)20-23-8-4-3-5-9-23/h3-15,26H,2,16-21H2,1H3,(H,30,33) |
| InChIKey | AXQZMFDSUHEFHT-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.04 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |