C24H25ClN2O2 — CID 42696491
N-(1-benzylpiperidin-4-yl)-N-[(2-chlorophenyl)methyl]furan-2-carboxamide (PubChem CID 42696491) has the molecular formula C24H25ClN2O2 and a molecular weight of 408.93 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N-[(2-chlorophenyl)methyl]furan-2-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N-[(2-chlorophenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42696491 |
| Molecular Formula | C24H25ClN2O2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N-[(2-chlorophenyl)methyl]furan-2-carboxamide |
| SMILES | O=C(c1ccco1)N(Cc1ccccc1Cl)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H25ClN2O2/c25-22-10-5-4-9-20(22)18-27(24(28)23-11-6-16-29-23)21-12-14-26(15-13-21)17-19-7-2-1-3-8-19/h1-11,16,21H,12-15,17-18H2 |
| InChIKey | BBFIGZLZAYSDKF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |