C23H23FN2O2 — CID 42853216
N-(1-benzylpiperidin-4-yl)-N-(4-fluorophenyl)furan-2-carboxamide (PubChem CID 42853216) has the molecular formula C23H23FN2O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N-(4-fluorophenyl)furan-2-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N-(4-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 42853216 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N-(4-fluorophenyl)furan-2-carboxamide |
| SMILES | O=C(c1ccco1)N(c1ccc(F)cc1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H23FN2O2/c24-19-8-10-20(11-9-19)26(23(27)22-7-4-16-28-22)21-12-14-25(15-13-21)17-18-5-2-1-3-6-18/h1-11,16,21H,12-15,17H2 |
| InChIKey | BEBJNZFOLJPIAU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |