C31H32N2O3 — CID 42858284
N-(4-ethylphenyl)-N-[1-[(3-phenoxyphenyl)methyl]piperidin-4-yl]furan-2-carboxamide (PubChem CID 42858284) has the molecular formula C31H32N2O3 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-(4-ethylphenyl)-N-[1-[(3-phenoxyphenyl)methyl]piperidin-4-yl]furan-2-carboxamide.
| Compound Name | N-(4-ethylphenyl)-N-[1-[(3-phenoxyphenyl)methyl]piperidin-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42858284 |
| Molecular Formula | C31H32N2O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | N-(4-ethylphenyl)-N-[1-[(3-phenoxyphenyl)methyl]piperidin-4-yl]furan-2-carboxamide |
| SMILES | CCc1ccc(N(C(=O)c2ccco2)C2CCN(Cc3cccc(Oc4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C31H32N2O3/c1-2-24-13-15-26(16-14-24)33(31(34)30-12-7-21-35-30)27-17-19-32(20-18-27)23-25-8-6-11-29(22-25)36-28-9-4-3-5-10-28/h3-16,21-22,27H,2,17-20,23H2,1H3 |
| InChIKey | CUCZKDUPBNRFJT-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |