C21H21FN2O2S — CID 42858050
N-(4-fluorophenyl)-N-[1-(thiophen-2-ylmethyl)piperidin-4-yl]furan-2-carboxamide (PubChem CID 42858050) has the molecular formula C21H21FN2O2S and a molecular weight of 384.48 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-[1-(thiophen-2-ylmethyl)piperidin-4-yl]furan-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-N-[1-(thiophen-2-ylmethyl)piperidin-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42858050 |
| Molecular Formula | C21H21FN2O2S |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-(4-fluorophenyl)-N-[1-(thiophen-2-ylmethyl)piperidin-4-yl]furan-2-carboxamide |
| SMILES | O=C(c1ccco1)N(c1ccc(F)cc1)C1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C21H21FN2O2S/c22-16-5-7-17(8-6-16)24(21(25)20-4-1-13-26-20)18-9-11-23(12-10-18)15-19-3-2-14-27-19/h1-8,13-14,18H,9-12,15H2 |
| InChIKey | NTMWYNQINDJXIC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |