C21H27FN2OS — CID 42858124
N-(3-fluoro-4-methylphenyl)-2-methyl-N-[1-(thiophen-2-ylmethyl)piperidin-4-yl]propanamide (PubChem CID 42858124) has the molecular formula C21H27FN2OS and a molecular weight of 374.53 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-2-methyl-N-[1-(thiophen-2-ylmethyl)piperidin-4-yl]propanamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-2-methyl-N-[1-(thiophen-2-ylmethyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 42858124 |
| Molecular Formula | C21H27FN2OS |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-2-methyl-N-[1-(thiophen-2-ylmethyl)piperidin-4-yl]propanamide |
| SMILES | Cc1ccc(N(C(=O)C(C)C)C2CCN(Cc3cccs3)CC2)cc1F |
| InChI | InChI=1S/C21H27FN2OS/c1-15(2)21(25)24(18-7-6-16(3)20(22)13-18)17-8-10-23(11-9-17)14-19-5-4-12-26-19/h4-7,12-13,15,17H,8-11,14H2,1-3H3 |
| InChIKey | YZPYKWHDPULPTR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |