C19H24FN3OS — CID 30645182
N-[(3-fluoro-4-methylphenyl)methyl]-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetamide (PubChem CID 30645182) has the molecular formula C19H24FN3OS and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[(3-fluoro-4-methylphenyl)methyl]-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetamide.
| Compound Name | N-[(3-fluoro-4-methylphenyl)methyl]-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 30645182 |
| Molecular Formula | C19H24FN3OS |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[(3-fluoro-4-methylphenyl)methyl]-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CN2CCN(Cc3cccs3)CC2)cc1F |
| InChI | InChI=1S/C19H24FN3OS/c1-15-4-5-16(11-18(15)20)12-21-19(24)14-23-8-6-22(7-9-23)13-17-3-2-10-25-17/h2-5,10-11H,6-9,12-14H2,1H3,(H,21,24) |
| InChIKey | YEJNPMJOFOADAO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |