C16H25N3O3S — CID 30965418
methyl 4-[[2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetyl]amino]butanoate (PubChem CID 30965418) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is methyl 4-[[2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 30965418 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | methyl 4-[[2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CN1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C16H25N3O3S/c1-22-16(21)5-2-6-17-15(20)13-19-9-7-18(8-10-19)12-14-4-3-11-23-14/h3-4,11H,2,5-10,12-13H2,1H3,(H,17,20) |
| InChIKey | KMGIGJJEEXLABF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|