C20H26N2OS — CID 23339066
N-phenyl-N-(1-propan-2-ylpiperidin-4-yl)-2-thiophen-2-ylacetamide (PubChem CID 23339066) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is N-phenyl-N-(1-propan-2-ylpiperidin-4-yl)-2-thiophen-2-ylacetamide.
| Compound Name | N-phenyl-N-(1-propan-2-ylpiperidin-4-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 23339066 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-phenyl-N-(1-propan-2-ylpiperidin-4-yl)-2-thiophen-2-ylacetamide |
| SMILES | CC(C)N1CCC(N(C(=O)Cc2cccs2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H26N2OS/c1-16(2)21-12-10-18(11-13-21)22(17-7-4-3-5-8-17)20(23)15-19-9-6-14-24-19/h3-9,14,16,18H,10-13,15H2,1-2H3 |
| InChIKey | KQKAJTJYHQAJCS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |