C22H28N2O5S — CID 86736486
oxalic acid;N-phenyl-N-(1-propan-2-ylpiperidin-4-yl)-2-thiophen-2-ylacetamide (PubChem CID 86736486) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is oxalic acid;N-phenyl-N-(1-propan-2-ylpiperidin-4-yl)-2-thiophen-2-ylacetamide.
| Compound Name | oxalic acid;N-phenyl-N-(1-propan-2-ylpiperidin-4-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 86736486 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | oxalic acid;N-phenyl-N-(1-propan-2-ylpiperidin-4-yl)-2-thiophen-2-ylacetamide |
| SMILES | CC(C)N1CCC(N(C(=O)Cc2cccs2)c2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H26N2OS.C2H2O4/c1-16(2)21-12-10-18(11-13-21)22(17-7-4-3-5-8-17)20(23)15-19-9-6-14-24-19;3-1(4)2(5)6/h3-9,14,16,18H,10-13,15H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | YNBRZIVOYFNSQY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|