C23H29NO — CID 21025612
N,2-diphenyl-N-(4-propan-2-ylcyclohexyl)acetamide (PubChem CID 21025612) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is N,2-diphenyl-N-(4-propan-2-ylcyclohexyl)acetamide.
| Compound Name | N,2-diphenyl-N-(4-propan-2-ylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 21025612 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | N,2-diphenyl-N-(4-propan-2-ylcyclohexyl)acetamide |
| SMILES | CC(C)C1CCC(N(C(=O)Cc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H29NO/c1-18(2)20-13-15-22(16-14-20)24(21-11-7-4-8-12-21)23(25)17-19-9-5-3-6-10-19/h3-12,18,20,22H,13-17H2,1-2H3 |
| InChIKey | BBYDGKZXSNDFIL-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |