C26H40N2O — CID 160668171
ethane;N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide (PubChem CID 160668171) has the molecular formula C26H40N2O and a molecular weight of 396.62 g/mol. Its IUPAC name is ethane;N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide.
| Compound Name | ethane;N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 160668171 |
| Molecular Formula | C26H40N2O |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | ethane;N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
| SMILES | CC.CC.CCC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N2O.2C2H6/c1-2-22(25)24(20-11-7-4-8-12-20)21-14-17-23(18-15-21)16-13-19-9-5-3-6-10-19;2*1-2/h3-12,21H,2,13-18H2,1H3;2*1-2H3 |
| InChIKey | RMOUWQUOBAJSPD-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |