C25H30N2O5 — CID 6445104
(E)-but-2-enedioic acid;N-phenyl-N-[1-(2-phenylethyl)pyrrolidin-3-yl]propanamide (PubChem CID 6445104) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-phenyl-N-[1-(2-phenylethyl)pyrrolidin-3-yl]propanamide.
| Compound Name | (E)-but-2-enedioic acid;N-phenyl-N-[1-(2-phenylethyl)pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 6445104 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (E)-but-2-enedioic acid;N-phenyl-N-[1-(2-phenylethyl)pyrrolidin-3-yl]propanamide |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H26N2O.C4H4O4/c1-2-21(24)23(19-11-7-4-8-12-19)20-14-16-22(17-20)15-13-18-9-5-3-6-10-18;5-3(6)1-2-4(7)8/h3-12,20H,2,13-17H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | WROIVZXFKKBPRO-WLHGVMLRSA-N |
| XLogP | 3.46 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|