C25H32N2O — CID 121490834
N-phenyl-N-[(3R,4R)-1-(2-phenylethyl)-3-prop-2-enylpiperidin-4-yl]propanamide (PubChem CID 121490834) has the molecular formula C25H32N2O and a molecular weight of 376.54 g/mol. Its IUPAC name is N-phenyl-N-[(3R,4R)-1-(2-phenylethyl)-3-prop-2-enylpiperidin-4-yl]propanamide.
| Compound Name | N-phenyl-N-[(3R,4R)-1-(2-phenylethyl)-3-prop-2-enylpiperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 121490834 |
| Molecular Formula | C25H32N2O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | N-phenyl-N-[(3R,4R)-1-(2-phenylethyl)-3-prop-2-enylpiperidin-4-yl]propanamide |
| SMILES | C=CC[C@@H]1CN(CCc2ccccc2)CC[C@H]1N(C(=O)CC)c1ccccc1 |
| InChI | InChI=1S/C25H32N2O/c1-3-11-22-20-26(18-16-21-12-7-5-8-13-21)19-17-24(22)27(25(28)4-2)23-14-9-6-10-15-23/h3,5-10,12-15,22,24H,1,4,11,16-20H2,2H3/t22-,24-/m1/s1 |
| InChIKey | BZXKQFFMDLTPJL-ISKFKSNPSA-N |
| XLogP | 4.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|