C28H42N2O3 — CID 166758697
1,1-diethoxyethane;N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide (PubChem CID 166758697) has the molecular formula C28H42N2O3 and a molecular weight of 454.66 g/mol. Its IUPAC name is 1,1-diethoxyethane;N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide.
| Compound Name | 1,1-diethoxyethane;N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 166758697 |
| Molecular Formula | C28H42N2O3 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | 1,1-diethoxyethane;N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCc2ccccc2)CC1.CCOC(C)OCC |
| InChI | InChI=1S/C22H28N2O.C6H14O2/c1-2-22(25)24(20-11-7-4-8-12-20)21-14-17-23(18-15-21)16-13-19-9-5-3-6-10-19;1-4-7-6(3)8-5-2/h3-12,21H,2,13-18H2,1H3;6H,4-5H2,1-3H3 |
| InChIKey | QADUGZCLYJSCKO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|