C29H39N3O2S — CID 153332308
N-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-N-phenylpropanamide;N-methyl-3-thiophen-2-ylpropan-1-amine (PubChem CID 153332308) has the molecular formula C29H39N3O2S and a molecular weight of 493.72 g/mol. Its IUPAC name is N-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-N-phenylpropanamide;N-methyl-3-thiophen-2-ylpropan-1-amine.
| Compound Name | N-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-N-phenylpropanamide;N-methyl-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 153332308 |
| Molecular Formula | C29H39N3O2S |
| Molecular Weight | 493.72 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | N-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-N-phenylpropanamide;N-methyl-3-thiophen-2-ylpropan-1-amine |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(Cc2ccccc2O)CC1.CNCCCc1cccs1 |
| InChI | InChI=1S/C21H26N2O2.C8H13NS/c1-2-21(25)23(18-9-4-3-5-10-18)19-12-14-22(15-13-19)16-17-8-6-7-11-20(17)24;1-9-6-2-4-8-5-3-7-10-8/h3-11,19,24H,2,12-16H2,1H3;3,5,7,9H,2,4,6H2,1H3 |
| InChIKey | NAPOQXMMNMABEP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.72 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|