C25H34N4O — CID 156786567
N-phenyl-N-[1-[2-(piperazin-1-ylmethyl)phenyl]piperidin-4-yl]propanamide (PubChem CID 156786567) has the molecular formula C25H34N4O and a molecular weight of 406.57 g/mol. Its IUPAC name is N-phenyl-N-[1-[2-(piperazin-1-ylmethyl)phenyl]piperidin-4-yl]propanamide.
| Compound Name | N-phenyl-N-[1-[2-(piperazin-1-ylmethyl)phenyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 156786567 |
| Molecular Formula | C25H34N4O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | N-phenyl-N-[1-[2-(piperazin-1-ylmethyl)phenyl]piperidin-4-yl]propanamide |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(c2ccccc2CN2CCNCC2)CC1 |
| InChI | InChI=1S/C25H34N4O/c1-2-25(30)29(22-9-4-3-5-10-22)23-12-16-28(17-13-23)24-11-7-6-8-21(24)20-27-18-14-26-15-19-27/h3-11,23,26H,2,12-20H2,1H3 |
| InChIKey | SGOZPXPQOYLORE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |