C16H22N2O5 — CID 117065158
oxalic acid;N-phenyl-N-piperidin-4-ylpropanamide (PubChem CID 117065158) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is oxalic acid;N-phenyl-N-piperidin-4-ylpropanamide.
| Compound Name | oxalic acid;N-phenyl-N-piperidin-4-ylpropanamide |
|---|---|
| PubChem CID | 117065158 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | oxalic acid;N-phenyl-N-piperidin-4-ylpropanamide |
| SMILES | CCC(=O)N(c1ccccc1)C1CCNCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H20N2O.C2H2O4/c1-2-14(17)16(12-6-4-3-5-7-12)13-8-10-15-11-9-13;3-1(4)2(5)6/h3-7,13,15H,2,8-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | OLFNESLXXQCODF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|