C20H28F3N3O3 — CID 175285258
N-cyclohexyl-N-phenyl-2-piperazin-1-ylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 175285258) has the molecular formula C20H28F3N3O3 and a molecular weight of 415.46 g/mol. Its IUPAC name is N-cyclohexyl-N-phenyl-2-piperazin-1-ylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclohexyl-N-phenyl-2-piperazin-1-ylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175285258 |
| Molecular Formula | C20H28F3N3O3 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N-cyclohexyl-N-phenyl-2-piperazin-1-ylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CN1CCNCC1)N(c1ccccc1)C1CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3O.C2HF3O2/c22-18(15-20-13-11-19-12-14-20)21(16-7-3-1-4-8-16)17-9-5-2-6-10-17;3-2(4,5)1(6)7/h1,3-4,7-8,17,19H,2,5-6,9-15H2;(H,6,7) |
| InChIKey | PLZJDSJVIUUBCV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |