C22H23FN2O2S2 — CID 42858562
4-fluoro-N-phenyl-N-[1-(thiophen-2-ylmethyl)piperidin-4-yl]benzenesulfonamide (PubChem CID 42858562) has the molecular formula C22H23FN2O2S2 and a molecular weight of 430.57 g/mol. Its IUPAC name is 4-fluoro-N-phenyl-N-[1-(thiophen-2-ylmethyl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-phenyl-N-[1-(thiophen-2-ylmethyl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 42858562 |
| Molecular Formula | C22H23FN2O2S2 |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-fluoro-N-phenyl-N-[1-(thiophen-2-ylmethyl)piperidin-4-yl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(F)cc1)N(c1ccccc1)C1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C22H23FN2O2S2/c23-18-8-10-22(11-9-18)29(26,27)25(19-5-2-1-3-6-19)20-12-14-24(15-13-20)17-21-7-4-16-28-21/h1-11,16,20H,12-15,17H2 |
| InChIKey | TZXSVKFKKLUFLO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |