C30H30N2O2S — CID 10184484
N-(1-benzylpiperidin-4-yl)-N,4-diphenylbenzenesulfonamide (PubChem CID 10184484) has the molecular formula C30H30N2O2S and a molecular weight of 482.65 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N,4-diphenylbenzenesulfonamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N,4-diphenylbenzenesulfonamide |
|---|---|
| PubChem CID | 10184484 |
| Molecular Formula | C30H30N2O2S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N,4-diphenylbenzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(-c2ccccc2)cc1)N(c1ccccc1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H30N2O2S/c33-35(34,30-18-16-27(17-19-30)26-12-6-2-7-13-26)32(28-14-8-3-9-15-28)29-20-22-31(23-21-29)24-25-10-4-1-5-11-25/h1-19,29H,20-24H2 |
| InChIKey | COHVVFURGOMBGT-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |