C24H27N3O3S — CID 42858646
N-(3-methoxyphenyl)-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]benzenesulfonamide (PubChem CID 42858646) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | N-(3-methoxyphenyl)-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 42858646 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-(3-methoxyphenyl)-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]benzenesulfonamide |
| SMILES | COc1cccc(N(C2CCN(Cc3cccnc3)CC2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H27N3O3S/c1-30-23-9-5-8-22(17-23)27(31(28,29)24-10-3-2-4-11-24)21-12-15-26(16-13-21)19-20-7-6-14-25-18-20/h2-11,14,17-18,21H,12-13,15-16,19H2,1H3 |
| InChIKey | YRVMFYWJMYFFHB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |