C22H22FN3OS — CID 42858063
N-(4-fluorophenyl)-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]thiophene-2-carboxamide (PubChem CID 42858063) has the molecular formula C22H22FN3OS and a molecular weight of 395.50 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42858063 |
| Molecular Formula | C22H22FN3OS |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-(4-fluorophenyl)-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(c1cccs1)N(c1ccc(F)cc1)C1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C22H22FN3OS/c23-17-6-8-19(9-7-17)26(22(27)21-5-3-15-28-21)20-10-13-25(14-11-20)16-18-4-1-2-12-24-18/h1-9,12,15,20H,10-11,13-14,16H2 |
| InChIKey | HHKQJEHOVWGAFP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |