C17H19N3OS — CID 97376927
[(3aR,6aR)-2-(pyridin-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-2-ylmethanone (PubChem CID 97376927) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is [(3aR,6aR)-2-(pyridin-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-2-ylmethanone.
| Compound Name | [(3aR,6aR)-2-(pyridin-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 97376927 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | [(3aR,6aR)-2-(pyridin-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1C[C@H]2CN(Cc3ccccn3)C[C@@H]2C1 |
| InChI | InChI=1S/C17H19N3OS/c21-17(16-5-3-7-22-16)20-10-13-8-19(9-14(13)11-20)12-15-4-1-2-6-18-15/h1-7,13-14H,8-12H2/t13-,14-/m1/s1 |
| InChIKey | CAUOMKYEGRQVSW-ZIAGYGMSSA-N |
| XLogP | 2.35 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |