C14H20N2OS — CID 97457824
[(3aS,6aR)-2-propan-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-2-ylmethanone (PubChem CID 97457824) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is [(3aS,6aR)-2-propan-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-2-ylmethanone.
| Compound Name | [(3aS,6aR)-2-propan-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 97457824 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | [(3aS,6aR)-2-propan-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-2-ylmethanone |
| SMILES | CC(C)N1C[C@H]2CN(C(=O)c3cccs3)C[C@H]2C1 |
| InChI | InChI=1S/C14H20N2OS/c1-10(2)15-6-11-8-16(9-12(11)7-15)14(17)13-4-3-5-18-13/h3-5,10-12H,6-9H2,1-2H3/t11-,12+ |
| InChIKey | OAVOKHXKQIUEEB-TXEJJXNPSA-N |
| XLogP | 2.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |