C17H20N2OS — CID 110602244
(3,5-dimethyl-4-phenylpiperazin-1-yl)-thiophen-2-ylmethanone (PubChem CID 110602244) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is (3,5-dimethyl-4-phenylpiperazin-1-yl)-thiophen-2-ylmethanone.
| Compound Name | (3,5-dimethyl-4-phenylpiperazin-1-yl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 110602244 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (3,5-dimethyl-4-phenylpiperazin-1-yl)-thiophen-2-ylmethanone |
| SMILES | CC1CN(C(=O)c2cccs2)CC(C)N1c1ccccc1 |
| InChI | InChI=1S/C17H20N2OS/c1-13-11-18(17(20)16-9-6-10-21-16)12-14(2)19(13)15-7-4-3-5-8-15/h3-10,13-14H,11-12H2,1-2H3 |
| InChIKey | GNONFMVNLINFAI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |