C19H21N3O2S — CID 90510999
(4-phenylpiperazin-1-yl)-[1-(thiophene-2-carbonyl)azetidin-3-yl]methanone (PubChem CID 90510999) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is (4-phenylpiperazin-1-yl)-[1-(thiophene-2-carbonyl)azetidin-3-yl]methanone.
| Compound Name | (4-phenylpiperazin-1-yl)-[1-(thiophene-2-carbonyl)azetidin-3-yl]methanone |
|---|---|
| PubChem CID | 90510999 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (4-phenylpiperazin-1-yl)-[1-(thiophene-2-carbonyl)azetidin-3-yl]methanone |
| SMILES | O=C(c1cccs1)N1CC(C(=O)N2CCN(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C19H21N3O2S/c23-18(15-13-22(14-15)19(24)17-7-4-12-25-17)21-10-8-20(9-11-21)16-5-2-1-3-6-16/h1-7,12,15H,8-11,13-14H2 |
| InChIKey | LWSWYMBGFQPOGA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |