C24H24FN3OS — CID 71532111
[(3S,3aS,7aR)-3-(4-fluorophenyl)-5-(pyridin-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-thiophen-2-ylmethanone (PubChem CID 71532111) has the molecular formula C24H24FN3OS and a molecular weight of 421.54 g/mol. Its IUPAC name is [(3S,3aS,7aR)-3-(4-fluorophenyl)-5-(pyridin-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [(3S,3aS,7aR)-3-(4-fluorophenyl)-5-(pyridin-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 71532111 |
| Molecular Formula | C24H24FN3OS |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [(3S,3aS,7aR)-3-(4-fluorophenyl)-5-(pyridin-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1C[C@H](c2ccc(F)cc2)[C@H]2CN(Cc3ccccn3)CC[C@H]21 |
| InChI | InChI=1S/C24H24FN3OS/c25-18-8-6-17(7-9-18)20-16-28(24(29)23-5-3-13-30-23)22-10-12-27(15-21(20)22)14-19-4-1-2-11-26-19/h1-9,11,13,20-22H,10,12,14-16H2/t20-,21-,22-/m1/s1 |
| InChIKey | XYSUWFQIVYPFDR-YPAWHYETSA-N |
| XLogP | 4.41 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |