C24H28F2N2O — CID 92553167
1-[(3S,3aS,7aR)-3-(4-fluorophenyl)-5-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-2-methylpropan-1-one (PubChem CID 92553167) has the molecular formula C24H28F2N2O and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-3-(4-fluorophenyl)-5-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(3S,3aS,7aR)-3-(4-fluorophenyl)-5-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 92553167 |
| Molecular Formula | C24H28F2N2O |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-[(3S,3aS,7aR)-3-(4-fluorophenyl)-5-[(3-fluorophenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1C[C@H](c2ccc(F)cc2)[C@H]2CN(Cc3cccc(F)c3)CC[C@H]21 |
| InChI | InChI=1S/C24H28F2N2O/c1-16(2)24(29)28-15-21(18-6-8-19(25)9-7-18)22-14-27(11-10-23(22)28)13-17-4-3-5-20(26)12-17/h3-9,12,16,21-23H,10-11,13-15H2,1-2H3/t21-,22-,23-/m1/s1 |
| InChIKey | GQPJMLDBTLVYFK-DNVJHFABSA-N |
| XLogP | 4.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |