C23H28N2OS — CID 92560873
[(3R,3aR,7aS)-5-[(3-methylphenyl)methyl]-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclopropylmethanone (PubChem CID 92560873) has the molecular formula C23H28N2OS and a molecular weight of 380.56 g/mol. Its IUPAC name is [(3R,3aR,7aS)-5-[(3-methylphenyl)methyl]-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclopropylmethanone.
| Compound Name | [(3R,3aR,7aS)-5-[(3-methylphenyl)methyl]-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 92560873 |
| Molecular Formula | C23H28N2OS |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | [(3R,3aR,7aS)-5-[(3-methylphenyl)methyl]-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclopropylmethanone |
| SMILES | Cc1cccc(CN2CC[C@H]3[C@@H](C2)[C@H](c2ccsc2)CN3C(=O)C2CC2)c1 |
| InChI | InChI=1S/C23H28N2OS/c1-16-3-2-4-17(11-16)12-24-9-7-22-21(13-24)20(19-8-10-27-15-19)14-25(22)23(26)18-5-6-18/h2-4,8,10-11,15,18,20-22H,5-7,9,12-14H2,1H3/t20-,21-,22-/m0/s1 |
| InChIKey | OBPCUZHNKXYEJF-FKBYEOEOSA-N |
| XLogP | 4.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |