C26H34N4O — CID 92560971
[(3S,3aS,7aR)-3-(3-methylphenyl)-5-[(2-methylpyrimidin-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclopentylmethanone (PubChem CID 92560971) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is [(3S,3aS,7aR)-3-(3-methylphenyl)-5-[(2-methylpyrimidin-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclopentylmethanone.
| Compound Name | [(3S,3aS,7aR)-3-(3-methylphenyl)-5-[(2-methylpyrimidin-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 92560971 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | [(3S,3aS,7aR)-3-(3-methylphenyl)-5-[(2-methylpyrimidin-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclopentylmethanone |
| SMILES | Cc1cccc([C@H]2CN(C(=O)C3CCCC3)[C@@H]3CCN(Cc4ccnc(C)n4)C[C@H]23)c1 |
| InChI | InChI=1S/C26H34N4O/c1-18-6-5-9-21(14-18)23-17-30(26(31)20-7-3-4-8-20)25-11-13-29(16-24(23)25)15-22-10-12-27-19(2)28-22/h5-6,9-10,12,14,20,23-25H,3-4,7-8,11,13,15-17H2,1-2H3/t23-,24-,25-/m1/s1 |
| InChIKey | UDDNSFXTJTVFTP-UBFVSLLYSA-N |
| XLogP | 4.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |