C27H34N2O3 — CID 92596520
[(3R,3aR,7aS)-3-(4-methoxyphenyl)-5-[(2-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclobutylmethanone (PubChem CID 92596520) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is [(3R,3aR,7aS)-3-(4-methoxyphenyl)-5-[(2-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclobutylmethanone.
| Compound Name | [(3R,3aR,7aS)-3-(4-methoxyphenyl)-5-[(2-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 92596520 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | [(3R,3aR,7aS)-3-(4-methoxyphenyl)-5-[(2-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclobutylmethanone |
| SMILES | COc1ccc([C@@H]2CN(C(=O)C3CCC3)[C@H]3CCN(Cc4ccccc4OC)C[C@@H]23)cc1 |
| InChI | InChI=1S/C27H34N2O3/c1-31-22-12-10-19(11-13-22)23-18-29(27(30)20-7-5-8-20)25-14-15-28(17-24(23)25)16-21-6-3-4-9-26(21)32-2/h3-4,6,9-13,20,23-25H,5,7-8,14-18H2,1-2H3/t23-,24-,25-/m0/s1 |
| InChIKey | OMQCOCJIIUTRIE-SDHOMARFSA-N |
| XLogP | 4.32 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |