C26H31FN2O2 — CID 92596509
[(3R,3aR,7aS)-5-[(4-fluorophenyl)methyl]-3-(4-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclobutylmethanone (PubChem CID 92596509) has the molecular formula C26H31FN2O2 and a molecular weight of 422.54 g/mol. Its IUPAC name is [(3R,3aR,7aS)-5-[(4-fluorophenyl)methyl]-3-(4-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclobutylmethanone.
| Compound Name | [(3R,3aR,7aS)-5-[(4-fluorophenyl)methyl]-3-(4-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 92596509 |
| Molecular Formula | C26H31FN2O2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | [(3R,3aR,7aS)-5-[(4-fluorophenyl)methyl]-3-(4-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclobutylmethanone |
| SMILES | COc1ccc([C@@H]2CN(C(=O)C3CCC3)[C@H]3CCN(Cc4ccc(F)cc4)C[C@@H]23)cc1 |
| InChI | InChI=1S/C26H31FN2O2/c1-31-22-11-7-19(8-12-22)23-17-29(26(30)20-3-2-4-20)25-13-14-28(16-24(23)25)15-18-5-9-21(27)10-6-18/h5-12,20,23-25H,2-4,13-17H2,1H3/t23-,24-,25-/m0/s1 |
| InChIKey | IXTUIGIVCSPWJD-SDHOMARFSA-N |
| XLogP | 4.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |