C24H32N2O2S — CID 92551838
1-[(3S,3aS,7aR)-5-[(4-methoxyphenyl)methyl]-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 92551838) has the molecular formula C24H32N2O2S and a molecular weight of 412.60 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-5-[(4-methoxyphenyl)methyl]-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(3S,3aS,7aR)-5-[(4-methoxyphenyl)methyl]-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 92551838 |
| Molecular Formula | C24H32N2O2S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-[(3S,3aS,7aR)-5-[(4-methoxyphenyl)methyl]-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | COc1ccc(CN2CC[C@@H]3[C@H](C2)[C@@H](c2ccsc2)CN3C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H32N2O2S/c1-24(2,3)23(27)26-15-20(18-10-12-29-16-18)21-14-25(11-9-22(21)26)13-17-5-7-19(28-4)8-6-17/h5-8,10,12,16,20-22H,9,11,13-15H2,1-4H3/t20-,21-,22-/m1/s1 |
| InChIKey | VRCYGJHTKUGRRK-YPAWHYETSA-N |
| XLogP | 4.62 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |