C24H32N4O2 — CID 92590132
[(3S,3aS,7aR)-5-[(1-ethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclopropylmethanone (PubChem CID 92590132) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is [(3S,3aS,7aR)-5-[(1-ethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclopropylmethanone.
| Compound Name | [(3S,3aS,7aR)-5-[(1-ethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 92590132 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | [(3S,3aS,7aR)-5-[(1-ethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-cyclopropylmethanone |
| SMILES | CCn1cc(CN2CC[C@@H]3[C@H](C2)[C@@H](c2ccc(OC)cc2)CN3C(=O)C2CC2)cn1 |
| InChI | InChI=1S/C24H32N4O2/c1-3-27-14-17(12-25-27)13-26-11-10-23-22(15-26)21(16-28(23)24(29)19-4-5-19)18-6-8-20(30-2)9-7-18/h6-9,12,14,19,21-23H,3-5,10-11,13,15-16H2,1-2H3/t21-,22-,23-/m1/s1 |
| InChIKey | YCTIAYMDWIEWRZ-DNVJHFABSA-N |
| XLogP | 3.14 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |